Difference between revisions of "SUCCSEMIALDDEHYDROG-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] == * smiles: ** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_18813 == * left end position: ** 709 * transcription direction: ** NEGATIVE * right end position: ** 2708 * centisome position: ** 25.51277...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-BUTYRYL-COA 2-METHYL-BUTYRYL-COA] ==
+
== Gene Tiso_gene_18813 ==
−
* smiles:
+
* left end position:
−
** CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 709
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 2-methylbutanoyl-CoA
+
** 2708
−
* molecular weight:
+
* centisome position:
−
** 847.62    
+
** 25.512775    
 
* Synonym(s):
 
* Synonym(s):
−
** S-2-methyl-butyryl-CoA
 
−
** 2-methylbutyryl-CoA
 
−
** α-methylbutyryl-CoA
 
−
** α-methylbutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[MCDH_2mb2coa]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
* [[DHRT_2mbcoa]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
−
* [[2KETO-3METHYLVALERATE-RXN]]
+
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=709}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266569 45266569]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2708}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57336 57336]
+
{{#set: centisome position=25.512775   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01033 C01033]
+
−
* HMDB : HMDB01041
+
−
{{#set: smiles=CCC(C)C(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LYNVNYDEQMMNMZ-XGXNYEOVSA-J}}
+
−
{{#set: common name=2-methylbutanoyl-CoA}}
+
−
{{#set: molecular weight=847.62   }}
+
−
{{#set: common name=S-2-methyl-butyryl-CoA|2-methylbutyryl-CoA|α-methylbutyryl-CoA|α-methylbutanoyl-CoA}}
+
−
{{#set: consumed by=MCDH_2mb2coa}}
+
−
{{#set: produced by=DHRT_2mbcoa}}
+
−
{{#set: consumed or produced by=2KETO-3METHYLVALERATE-RXN}}
+

Revision as of 18:59, 18 March 2018

Gene Tiso_gene_18813

  • left end position:
    • 709
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2708
  • centisome position:
    • 25.512775
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SUCCSEMIALDDEHYDROG-RXN&oldid=21108"