Difference between revisions of "Tiso gene 10914"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_6877 == * left end position: ** 9970 * transcription direction: ** POSITIVE * right end position: ** 11662 * centisome position: ** 84.9016...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_6877 == |
− | * | + | * left end position: |
− | ** | + | ** 9970 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 11662 |
− | * | + | * centisome position: |
− | ** | + | ** 84.90164 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * [[3.3.2.9-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
− | * | + | ***ec-number |
− | + | * [[TROPINESTERASE-RXN]] | |
− | * [[ | + | ** in-silico_annotation |
+ | ***ec-number | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=9970}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=11662}} | |
− | + | {{#set: centisome position=84.90164 }} | |
− | + | {{#set: reaction associated=3.3.2.9-RXN|TROPINESTERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Revision as of 17:59, 18 March 2018
Gene Tiso_gene_6877
- left end position:
- 9970
- transcription direction:
- POSITIVE
- right end position:
- 11662
- centisome position:
- 84.90164
- Synonym(s):
Reactions associated
- 3.3.2.9-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- TROPINESTERASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation