Difference between revisions of "TRNA-2-thiouridine34"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRPP PRPP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(OP([O-])(=O)OP([O-])(=O)[O-])C(O)C(O)1) * i...") |
(Created page with "Category:Gene == Gene Tiso_gene_15067 == * left end position: ** 496 * transcription direction: ** NEGATIVE * right end position: ** 5231 * centisome position: ** 9.435039...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15067 == |
− | * | + | * left end position: |
− | ** | + | ** 496 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 5231 |
− | * | + | * centisome position: |
− | ** | + | ** 9.435039 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[3.2.1.21-RXN]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * | + | * [[RXN-10769]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | * [[RXN-10773]] |
− | * [[ | + | ** in-silico_annotation |
− | + | ***ec-number | |
− | * [[ | + | * [[RXN-13602]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[RXN-13603]] |
− | * [[ | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[RXN-14179]] |
− | * [[ | + | ** in-silico_annotation |
+ | ***ec-number | ||
+ | * [[RXN-5341]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-8036]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | * [[RXN-9674]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3121]] | ||
+ | * [[PWY-6002]] | ||
+ | * [[PWY-6788]] | ||
+ | * [[PWY-5176]] | ||
+ | * [[PWY-7092]] | ||
+ | * [[PWY-7091]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=496}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=5231}} | |
− | + | {{#set: centisome position=9.435039 }} | |
− | + | {{#set: reaction associated=3.2.1.21-RXN|RXN-10769|RXN-10773|RXN-13602|RXN-13603|RXN-14179|RXN-5341|RXN-8036|RXN-9674}} | |
− | + | {{#set: pathway associated=PWY-3121|PWY-6002|PWY-6788|PWY-5176|PWY-7092|PWY-7091}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 17:59, 18 March 2018
Gene Tiso_gene_15067
- left end position:
- 496
- transcription direction:
- NEGATIVE
- right end position:
- 5231
- centisome position:
- 9.435039
- Synonym(s):
Reactions associated
- 3.2.1.21-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-10769
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-10773
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13602
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-13603
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-14179
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-5341
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-8036
- in-silico_annotation
- ec-number
- in-silico_annotation
- RXN-9674
- in-silico_annotation
- ec-number
- in-silico_annotation