Difference between revisions of "PWY-7341"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-377 CPD-377] == * smiles: ** C(C(C(C(C(CO)O)O)O)=O)([O-])=O * inchi key: ** InChIKey=VBUYCZ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7466 PWY-7466] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7466 PWY-7466] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-40674 TAX-40674] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 2- | + | ** acetone degradation III (to propane-1,2-diol) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''2''' reactions found over '''4''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[ACETOACETATE-DECARBOXYLASE-RXN]] |
− | * [ | + | ** 0 associated gene: |
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[RXN-8630]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_1035]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=ISOPROPANOL-DEHYDROGENASE-NADP+-RXN ISOPROPANOL-DEHYDROGENASE-NADP+-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8632 RXN-8632] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-40674}} | |
− | + | {{#set: common name=acetone degradation III (to propane-1,2-diol)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name=2- | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:00, 18 March 2018
Pathway PWY-7466
- taxonomic range:
- common name:
- acetone degradation III (to propane-1,2-diol)
- Synonym(s):
Reaction(s) found
2 reactions found over 4 reactions in the full pathway
- ACETOACETATE-DECARBOXYLASE-RXN
- 0 associated gene:
- 2 reconstruction source(s) associated:
- RXN-8630
- 1 associated gene(s):
- 1 reconstruction source(s) associated: