Difference between revisions of "Tiso gene 7682"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** mevalonate pathway II (archaea) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** isoprenoid pathway |
− | ** | + | ** MVA pathway |
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''5''' reactions found over '''7''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[1.1.1.34-RXN]] |
− | * [ | + | ** 2 associated gene(s): |
− | * [ | + | *** [[Tiso_gene_17889]] |
+ | *** [[Tiso_gene_16182]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[ACETYL-COA-ACETYLTRANSFER-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_16181]] | ||
+ | *** [[Tiso_gene_15327]] | ||
+ | *** [[Tiso_gene_17451]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14303]] | ||
+ | *** [[Tiso_gene_9236]] | ||
+ | *** [[Tiso_gene_8563]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[IPPISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_8653]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[MEVALONATE-KINASE-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_3811]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10067 RXN-10067] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10068 RXN-10068] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | + | {{#set: common name=mevalonate pathway II (archaea)}} | |
− | + | {{#set: common name=isoprenoid pathway|MVA pathway}} | |
− | + | {{#set: reaction found=5}} | |
− | + | {{#set: total reaction=7}} | |
− | + | {{#set: completion rate=71.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:00, 18 March 2018
Pathway PWY-6174
- taxonomic range:
- common name:
- mevalonate pathway II (archaea)
- Synonym(s):
- isoprenoid pathway
- MVA pathway
Reaction(s) found
5 reactions found over 7 reactions in the full pathway
- 1.1.1.34-RXN
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
- ACETYL-COA-ACETYLTRANSFER-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN
- 3 associated gene(s):
- 3 reconstruction source(s) associated:
- IPPISOM-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- MEVALONATE-KINASE-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated: