Difference between revisions of "Tiso gene 7682"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] == * smiles: ** C(=O)([O-])CC(NC(N)=O)C([O-])=O *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMYUL-L-ASPARTATE CARBAMYUL-L-ASPARTATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6174 PWY-6174] ==
−
* smiles:
+
* taxonomic range:
−
** C(=O)([O-])CC(NC(N)=O)C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=HLKXYZVTANABHZ-REOHCLBHSA-L
+
 
* common name:
 
* common name:
−
** N-carbamoyl-L-aspartate
+
** mevalonate pathway II (archaea)
−
* molecular weight:
+
−
** 174.113   
+
 
* Synonym(s):
 
* Synonym(s):
−
** carbamyul-L-aspartate
+
** isoprenoid pathway
−
** carbamyul-aspartate
+
** MVA pathway
−
** carbamoyl-aspartate
+
−
** carbamyl-aspartate
+
−
** carbamyl-L-aspartate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''5''' reactions found over '''7''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[1.1.1.34-RXN]]
−
* [[ASPCARBTRANS-RXN]]
+
** 2 associated gene(s):
−
* [[DIHYDROOROT-RXN]]
+
*** [[Tiso_gene_17889]]
 +
*** [[Tiso_gene_16182]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_14303]]
 +
*** [[Tiso_gene_9236]]
 +
*** [[Tiso_gene_8563]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IPPISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8653]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3811]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10067 RXN-10067]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-10068 RXN-10068]
 
== External links  ==
 
== External links  ==
−
* CAS : 16649-79-9
+
{{#set: taxonomic range=TAX-2157}}
−
* METABOLIGHTS : MTBLC32814
+
{{#set: common name=mevalonate pathway II (archaea)}}
−
* PUBCHEM:
+
{{#set: common name=isoprenoid pathway|MVA pathway}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460257 5460257]
+
{{#set: reaction found=5}}
−
* HMDB : HMDB00828
+
{{#set: total reaction=7}}
−
* LIGAND-CPD:
+
{{#set: completion rate=71.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00438 C00438]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.10718031.html 10718031]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32814 32814]
+
−
* BIGG : cbasp
+
−
{{#set: smiles=C(=O)([O-])CC(NC(N)=O)C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HLKXYZVTANABHZ-REOHCLBHSA-L}}
+
−
{{#set: common name=N-carbamoyl-L-aspartate}}
+
−
{{#set: molecular weight=174.113    }}
+
−
{{#set: common name=carbamyul-L-aspartate|carbamyul-aspartate|carbamoyl-aspartate|carbamyl-aspartate|carbamyl-L-aspartate}}
+
−
{{#set: consumed or produced by=ASPCARBTRANS-RXN|DIHYDROOROT-RXN}}
+

Revision as of 18:00, 18 March 2018

Pathway PWY-6174

  • taxonomic range:
  • common name:
    • mevalonate pathway II (archaea)
  • Synonym(s):
    • isoprenoid pathway
    • MVA pathway

Reaction(s) found

5 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7682&oldid=21205"