Difference between revisions of "Guanine9-in-tRNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M |
* common name: | * common name: | ||
− | ** | + | ** S-sulfo-L-cysteine |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 200.204 |
* Synonym(s): | * Synonym(s): | ||
+ | ** S-sulfocysteine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[SULFOCYS-RXN]] |
− | + | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C( | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824] |
− | {{#set: inchi key=InChIKey= | + | * HMDB : HMDB00731 |
− | {{#set: common name= | + | {{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}} |
− | {{#set: | + | {{#set: common name=S-sulfo-L-cysteine}} |
− | {{#set: | + | {{#set: molecular weight=200.204 }} |
+ | {{#set: common name=S-sulfocysteine}} | ||
+ | {{#set: reversible reaction associated=SULFOCYS-RXN}} |
Revision as of 18:00, 18 March 2018
Contents
Metabolite SULFO-CYSTEINE
- smiles:
- C(C([N+])C(=O)[O-])SS([O-])(=O)=O
- inchi key:
- InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
- common name:
- S-sulfo-L-cysteine
- molecular weight:
- 200.204
- Synonym(s):
- S-sulfocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([N+])C(=O)[O-])SS([O-])(=O)=O" cannot be used as a page name in this wiki.