Difference between revisions of "NADPHOS-DEPHOS-PWY-1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3801 PWY-3801] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | |
* common name: | * common name: | ||
− | ** ( | + | ** sucrose degradation II (sucrose synthase) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | '''4''' reactions found over '''5''' reactions in the full pathway |
− | * [[RXN- | + | * [[FRUCTOKINASE-RXN]] |
− | + | ** 3 associated gene(s): | |
− | * [[RXN- | + | *** [[Tiso_gene_17974]] |
− | == Reaction(s) | + | *** [[Tiso_gene_3107]] |
+ | *** [[Tiso_gene_1303]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | * [[GLUC1PURIDYLTRANS-RXN]] | ||
+ | ** 14 associated gene(s): | ||
+ | *** [[Tiso_gene_6459]] | ||
+ | *** [[Tiso_gene_5879]] | ||
+ | *** [[Tiso_gene_17566]] | ||
+ | *** [[Tiso_gene_16930]] | ||
+ | *** [[Tiso_gene_14796]] | ||
+ | *** [[Tiso_gene_9110]] | ||
+ | *** [[Tiso_gene_17531]] | ||
+ | *** [[Tiso_gene_4816]] | ||
+ | *** [[Tiso_gene_7102]] | ||
+ | *** [[Tiso_gene_13477]] | ||
+ | *** [[Tiso_gene_7440]] | ||
+ | *** [[Tiso_gene_11401]] | ||
+ | *** [[Tiso_gene_6457]] | ||
+ | *** [[Tiso_gene_6458]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[PGLUCISOM-RXN]] | ||
+ | ** 1 associated gene(s): | ||
+ | *** [[Tiso_gene_19480]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[PHOSPHOGLUCMUT-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_13477]] | ||
+ | *** [[Tiso_gene_4816]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-SYNTHASE-RXN SUCROSE-SYNTHASE-RXN] | ||
== External links == | == External links == | ||
− | * | + | * ARACYC: |
− | ** [http:// | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-3801 PWY-3801] |
− | + | {{#set: taxonomic range=TAX-1117}} | |
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: common name=sucrose degradation II (sucrose synthase)}} | |
− | + | {{#set: reaction found=4}} | |
− | + | {{#set: total reaction=5}} | |
− | {{#set: | + | {{#set: completion rate=80.0}} |
− | {{#set: | + | |
− | {{#set: common name=( | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:01, 18 March 2018
Pathway PWY-3801
- taxonomic range:
- common name:
- sucrose degradation II (sucrose synthase)
- Synonym(s):
Reaction(s) found
4 reactions found over 5 reactions in the full pathway
- FRUCTOKINASE-RXN
- 3 associated gene(s):
- 4 reconstruction source(s) associated:
- GLUC1PURIDYLTRANS-RXN
- 14 associated gene(s):
- 4 reconstruction source(s) associated:
- PGLUCISOM-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- PHOSPHOGLUCMUT-RXN
- 2 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC: