Difference between revisions of "Tiso gene 9871"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] == * smiles: ** C(=CC(=O)[O-])C(N)=O * inchi key: ** InChIKey=FSQQTNAZHBEJ...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALEAMATE MALEAMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6960 PWY-6960] ==
−
* smiles:
+
* taxonomic range:
−
** C(=CC(=O)[O-])C(N)=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M
+
 
* common name:
 
* common name:
−
** maleamate
+
** L-ascorbate degradation III
−
* molecular weight:
+
−
** 114.08   
+
 
* Synonym(s):
 
* Synonym(s):
−
** maleic acid monoamide
 
−
** maleamic acid
 
−
** (Z)-4-amino-4-oxo-but-2-enoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-646]]
+
'''3''' reactions found over '''6''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-12440]]
−
== Reaction(s) of unknown directionality ==
+
** 3 associated gene(s):
 +
*** [[Tiso_gene_15962]]
 +
*** [[Tiso_gene_16028]]
 +
*** [[Tiso_gene_5435]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12869]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[RXN-12872]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12873 RXN-12873]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12874 RXN-12874]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12875 RXN-12875]
 
== External links  ==
 
== External links  ==
−
* CAS : 557-24-4
+
{{#set: taxonomic range=TAX-33090}}
−
* PUBCHEM:
+
{{#set: common name=L-ascorbate degradation III}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460391 5460391]
+
{{#set: reaction found=3}}
−
* CHEMSPIDER:
+
{{#set: total reaction=6}}
−
** [http://www.chemspider.com/Chemical-Structure.4573932.html 4573932]
+
{{#set: completion rate=50.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16146 16146]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01596 C01596]
+
−
{{#set: smiles=C(=CC(=O)[O-])C(N)=O}}
+
−
{{#set: inchi key=InChIKey=FSQQTNAZHBEJLS-UPHRSURJSA-M}}
+
−
{{#set: common name=maleamate}}
+
−
{{#set: molecular weight=114.08    }}
+
−
{{#set: common name=maleic acid monoamide|maleamic acid|(Z)-4-amino-4-oxo-but-2-enoate}}
+
−
{{#set: consumed by=RXN-646}}
+

Revision as of 18:01, 18 March 2018

Pathway PWY-6960

  • taxonomic range:
  • common name:
    • L-ascorbate degradation III
  • Synonym(s):

Reaction(s) found

3 reactions found over 6 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9871&oldid=21317"