Difference between revisions of "BIOTIN-CARBOXYL-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01251 R01251] == * direction: ** LEFT-TO-RIGHT * common name: ** R36 * Synonym(s): == Reaction Fo...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] == * smiles: ** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01251 R01251] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
 
* common name:
 
* common name:
−
** R36
+
** (2E,11Z)-octadecenoyl-CoA
 +
* molecular weight:
 +
** 1025.937   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:2-Δ2,Δ11-CoA
 +
** 2-trans,11-cis-octadecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[L-DELTA1-PYRROLINE_5-CARBOXYLATE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADPH]][c] '''=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[PRO]][c]
+
* [[RXN-17784]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 (S)-1-pyrroline-5-carboxylate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADPH[c] '''=>''' 1.0 NADP+[c] '''+''' 1.0 L-proline[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8625]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: common name=R36}}
+
{{#set: inchi key=InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J}}
−
{{#set: gene associated=Tiso_gene_8625}}
+
{{#set: common name=(2E,11Z)-octadecenoyl-CoA}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=1025.937    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=18:2-Δ2,Δ11-CoA|2-trans,11-cis-octadecenoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: produced by=RXN-17784}}
−
{{#set: reconstruction source=synechocystis}}
+

Revision as of 18:01, 18 March 2018

Metabolite CPD-19163

  • smiles:
    • CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=OPMPWWFMNYWBGF-PKYBCSRXSA-J
  • common name:
    • (2E,11Z)-octadecenoyl-CoA
  • molecular weight:
    • 1025.937
  • Synonym(s):
    • 18:2-Δ2,Δ11-CoA
    • 2-trans,11-cis-octadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BIOTIN-CARBOXYL-RXN&oldid=21337"