Difference between revisions of "PWY-7198"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-674 CPD-674] == * smiles: ** C(=O)([O-])C=CC1(=CC=CC=C1) * inchi key: ** InChIKey=WBYWAXJHA...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7659 PWY-7659] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7659 PWY-7659] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** viridicatumtoxin biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''1''' reactions found over '''9''' reactions in the full pathway |
| − | * [[ | + | * [[GPPSYN-RXN]] |
| − | == Reaction(s) | + | ** 9 associated gene(s): |
| − | == | + | *** [[Tiso_gene_19542]] |
| + | *** [[Tiso_gene_18201]] | ||
| + | *** [[Tiso_gene_16284]] | ||
| + | *** [[Tiso_gene_2848]] | ||
| + | *** [[Tiso_gene_1035]] | ||
| + | *** [[Tiso_gene_4719]] | ||
| + | *** [[Tiso_gene_11582]] | ||
| + | *** [[Tiso_gene_13582]] | ||
| + | *** [[Tiso_gene_10317]] | ||
| + | ** 5 reconstruction source(s) associated: | ||
| + | *** [[orthology-athaliana]] | ||
| + | *** [[orthology-creinhardtii]] | ||
| + | *** [[orthology-synechocystis]] | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | *** [[manual-primary_network]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16575 RXN-16575] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16576 RXN-16576] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16577 RXN-16577] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16578 RXN-16578] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16579 RXN-16579] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16580 RXN-16580] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16581 RXN-16581] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16582 RXN-16582] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-4751}} | |
| − | + | {{#set: common name=viridicatumtoxin biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=11.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 18:01, 18 March 2018
Pathway PWY-7659
- taxonomic range:
- common name:
- viridicatumtoxin biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- GPPSYN-RXN
- 9 associated gene(s):
- 5 reconstruction source(s) associated:
