Difference between revisions of "Tiso gene 15682"

Revision as of 18:01, 18 March 2018

"CC(C(=O)CC(=O)[O-])CC(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_9519 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10826 CPD-10826] ==
+* smiles:
+** CC(C(=O)CC(=O)[O-])CC(=O)[O-]
+* inchi key:
+** InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L
+* common name:
+** 4-methyl-3-oxoadipate
+* molecular weight:
+** 172.137
 * Synonym(s):
+** 4-methyl-3-ketoadipate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[ARYLSULFAT-RXN]]
+== Reaction(s) known to produce the compound ==
-** [[pantograph]]-[[esiliculosus]]
+* [[RXN-10083]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: reaction associated=ARYLSULFAT-RXN}}
+* PUBCHEM:
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123441 44123441]
+{{#set: smiles=CC(C(=O)CC(=O)[O-])CC(=O)[O-]}}
+{{#set: inchi key=InChIKey=HKHNBKNLBZMXIV-UHFFFAOYSA-L}}
+{{#set: common name=4-methyl-3-oxoadipate}}
+{{#set: molecular weight=172.137    }}
+{{#set: common name=4-methyl-3-ketoadipate}}
+{{#set: produced by=RXN-10083}}