Difference between revisions of "PWY-7161"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=...") |
|||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-138 CPD1F-138] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O))) |
| − | ** | + | * inchi key: |
| + | ** InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** gibberellin A12-aldehyde |
| + | * molecular weight: | ||
| + | ** 315.431 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** GA12-aldehyde | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN1F-161]] | |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN1F-160]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244417 25244417] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57432 57432] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06093 C06093] |
| − | {{#set: | + | * HMDB : HMDB39484 |
| − | {{#set: | + | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))}} |
| + | {{#set: inchi key=InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M}} | ||
| + | {{#set: common name=gibberellin A12-aldehyde}} | ||
| + | {{#set: molecular weight=315.431 }} | ||
| + | {{#set: common name=GA12-aldehyde}} | ||
| + | {{#set: consumed by=RXN1F-161}} | ||
| + | {{#set: produced by=RXN1F-160}} | ||
Revision as of 18:02, 18 March 2018
Contents
Metabolite CPD1F-138
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))
- inchi key:
- InChIKey=ZCTUNYRXJKLWPY-LLCOKINKSA-M
- common name:
- gibberellin A12-aldehyde
- molecular weight:
- 315.431
- Synonym(s):
- GA12-aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C=O)))" cannot be used as a page name in this wiki.
