Difference between revisions of "Tiso gene 1943"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] == * smiles: ** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC) * i...")
(Created page with "Category:Gene == Gene Tiso_gene_15379 == * left end position: ** 348 * transcription direction: ** NEGATIVE * right end position: ** 2311 * centisome position: ** 6.884273...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14601 CPD-14601] ==
+
== Gene Tiso_gene_15379 ==
−
* smiles:
+
* left end position:
−
** CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)
+
** 348
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** mycophenolate
+
** 2311
−
* molecular weight:
+
* centisome position:
−
** 319.333    
+
** 6.884273    
 
* Synonym(s):
 
* Synonym(s):
−
** mycophenolic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13608]]
+
* [[DIHYDROOROT-RXN]]
−
* [[RXN-13607]]
+
** in-silico_annotation
−
== Reaction(s) known to produce the compound ==
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[synechocystis]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-7790]]
 +
* [[PWY-7791]]
 +
* [[PWY-5686]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=348}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6918995 6918995]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=2311}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62932 62932]
+
{{#set: centisome position=6.884273   }}
−
{{#set: smiles=CC(CCC([O-])=O)=CCC1(=C(C(C)=C2(COC(=O)C(=C(O)1)2))OC)}}
+
{{#set: reaction associated=DIHYDROOROT-RXN}}
−
{{#set: inchi key=InChIKey=HPNSFSBZBAHARI-RUDMXATFSA-M}}
+
{{#set: pathway associated=PWY-7790|PWY-7791|PWY-5686}}
−
{{#set: common name=mycophenolate}}
+
−
{{#set: molecular weight=319.333   }}
+
−
{{#set: common name=mycophenolic acid}}
+
−
{{#set: consumed by=RXN-13608|RXN-13607}}
+

Revision as of 18:03, 18 March 2018

Gene Tiso_gene_15379

  • left end position:
    • 348
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2311
  • centisome position:
    • 6.884273
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1943&oldid=21509"