Difference between revisions of "PWY-6945"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14240 RXN-14240] == * direction: ** LEFT-TO-RIGHT * common name: ** baicalein peroxidase ** asc...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7014 CPD-7014] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14240 RXN-14240] ==
−
* smiles:
+
* direction:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** chlorophyllide b
+
** baicalein peroxidase
−
* molecular weight:
+
** ascorbate_peroxidase
−
** 626.95   
+
** ORF
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.11.1.7 EC-1.11.1.7]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-7674]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-12724]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''=>''' 1 [[CPD-15172]][c] '''+''' 2 [[WATER]][c]
−
* [[RXN-7677]]
+
* With common name(s):
−
* [[RXN-13398]]
+
** 1 baicalein[c] '''+''' 1 hydrogen peroxide[c] '''=>''' 1 6,7-dehydrobaicalein[c] '''+''' 2 H2O[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[RXN-7673]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_17551]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_19683]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_7067]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_20206]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_16028]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_15962]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_5857]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_11016]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_9359]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_15820]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
* [[Tiso_gene_6431]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7214]], baicalein degradation (hydrogen peroxide detoxification): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7214 PWY-7214]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658741 90658741]
+
{{#set: common name=baicalein peroxidase}}
−
* CHEBI:
+
{{#set: common name=ascorbate_peroxidase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58686 58686]
+
{{#set: common name=ORF}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.11.1.7}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16541 C16541]
+
{{#set: gene associated=Tiso_gene_17551|Tiso_gene_19683|Tiso_gene_7067|Tiso_gene_20206|Tiso_gene_16028|Tiso_gene_15962|Tiso_gene_5857|Tiso_gene_11016|Tiso_gene_9359|Tiso_gene_15820|Tiso_gene_6431}}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: in pathway=PWY-7214}}
−
{{#set: common name=chlorophyllide b}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: molecular weight=626.95    }}
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: consumed by=RXN-7674}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: produced by=RXN-7677|RXN-13398}}
+
−
{{#set: consumed or produced by=RXN-7673}}
+

Revision as of 18:03, 18 March 2018

Reaction RXN-14240

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • baicalein peroxidase
    • ascorbate_peroxidase
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7214, baicalein degradation (hydrogen peroxide detoxification): PWY-7214
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6945&oldid=21530"