Difference between revisions of "Tiso gene 14940"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucuronides Beta-D-Glucuronides] == * common name: ** a β-D-glucuronoside * Synony...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == |
+ | * smiles: | ||
+ | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** quinoxaline-2-carboxyl adenylate |
+ | * molecular weight: | ||
+ | ** 502.359 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17155]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331] |
− | {{#set: consumed by= | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}} |
+ | {{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}} | ||
+ | {{#set: common name=quinoxaline-2-carboxyl adenylate}} | ||
+ | {{#set: molecular weight=502.359 }} | ||
+ | {{#set: consumed by=RXN-17155}} |
Revision as of 18:04, 18 March 2018
Contents
Metabolite CPD-18550
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
- inchi key:
- InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
- common name:
- quinoxaline-2-carboxyl adenylate
- molecular weight:
- 502.359
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.