Difference between revisions of "Tiso gene 14940"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucuronides Beta-D-Glucuronides] == * common name: ** a β-D-glucuronoside * Synony...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Glucuronides Beta-D-Glucuronides] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18550 CPD-18550] ==
 +
* smiles:
 +
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
 +
* inchi key:
 +
** InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
 
* common name:
 
* common name:
** a β-D-glucuronoside
+
** quinoxaline-2-carboxyl adenylate
 +
* molecular weight:
 +
** 502.359   
 
* Synonym(s):
 
* Synonym(s):
** a β-D-glucuronoside
 
** an acceptor β-D-glucuronoside
 
** a glucuronide
 
** a β-D-glucosiduronate
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BETA-GLUCURONID-RXN]]
+
* [[RXN-17155]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a β-D-glucuronoside}}
+
* PUBCHEM:
{{#set: common name=a β-D-glucuronoside|an acceptor β-D-glucuronoside|a glucuronide|a β-D-glucosiduronate}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515331 102515331]
{{#set: consumed by=BETA-GLUCURONID-RXN}}
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O}}
 +
{{#set: inchi key=InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M}}
 +
{{#set: common name=quinoxaline-2-carboxyl adenylate}}
 +
{{#set: molecular weight=502.359    }}
 +
{{#set: consumed by=RXN-17155}}

Revision as of 18:04, 18 March 2018

Metabolite CPD-18550

  • smiles:
    • C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O
  • inchi key:
    • InChIKey=VMJWEICPCDRXQL-SCFUHWHPSA-M
  • common name:
    • quinoxaline-2-carboxyl adenylate
  • molecular weight:
    • 502.359
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OC(=O)C4(C=NC5(=CC=CC=C(N=4)5)))([O-])=O" cannot be used as a page name in this wiki.