Difference between revisions of "PWY-7339"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] == * smiles: ** C(O)(C([O-])=O)NC(N)=O * inchi key: ** InChIKey=NWZYYCVIOKVT...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6333 PWY-6333] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** C(O)(C([O-])=O)NC(N)=O
 +
* inchi key:
 +
** InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
 
* common name:
 
* common name:
** acetaldehyde biosynthesis I
+
** S-ureidoglycolate
 +
* molecular weight:
 +
** 133.083   
 
* Synonym(s):
 
* Synonym(s):
** anoxic acetaldehyde biosynthesis
+
** (-)-ureidoglycolate
** flooding related acetaldehyde biosynthesis
+
** ureidoglycolate
 +
** S-(-)-ureidoglycolate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''1''' reactions found over '''1''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[ALCOHOL-DEHYDROG-RXN]]
+
* [[ALLANTOICASE-RXN]]
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* CAS : 2017665
{{#set: common name=acetaldehyde biosynthesis I}}
+
* PUBCHEM:
{{#set: common name=anoxic acetaldehyde biosynthesis|flooding related acetaldehyde biosynthesis}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615273 23615273]
{{#set: reaction found=1}}
+
* HMDB : HMDB01005
{{#set: reaction not found=1}}
+
* LIGAND-CPD:
{{#set: completion rate=100.0}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00603 C00603]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.19951218.html 19951218]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57296 57296]
 +
* BIGG : urdglyc
 +
{{#set: smiles=C(O)(C([O-])=O)NC(N)=O}}
 +
{{#set: inchi key=InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M}}
 +
{{#set: common name=S-ureidoglycolate}}
 +
{{#set: molecular weight=133.083    }}
 +
{{#set: common name=(-)-ureidoglycolate|ureidoglycolate|S-(-)-ureidoglycolate}}
 +
{{#set: produced by=ALLANTOICASE-RXN}}

Revision as of 18:04, 18 March 2018

Metabolite CPD-1091

  • smiles:
    • C(O)(C([O-])=O)NC(N)=O
  • inchi key:
    • InChIKey=NWZYYCVIOKVTII-SFOWXEAESA-M
  • common name:
    • S-ureidoglycolate
  • molecular weight:
    • 133.083
  • Synonym(s):
    • (-)-ureidoglycolate
    • ureidoglycolate
    • S-(-)-ureidoglycolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)(C([O-])=O)NC(N)=O" cannot be used as a page name in this wiki.