Difference between revisions of "R00939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] == * smiles: ** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(...")
(Created page with "Category:Gene == Gene Tiso_gene_17238 == * left end position: ** 22 * transcription direction: ** NEGATIVE * right end position: ** 1309 * centisome position: ** 0.5736636...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17858 CPD-17858] ==
+
== Gene Tiso_gene_17238 ==
−
* smiles:
+
* left end position:
−
** CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C
+
** 22
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** ω-saturated C55 dolichol phosphate
+
** 1309
−
* molecular weight:
+
* centisome position:
−
** 849.311    
+
** 0.57366365    
 
* Synonym(s):
 
* Synonym(s):
−
** ω-saturated dolichol-11 phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16602]]
+
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=22}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819874 91819874]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CC(C)CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(CCOP(=O)([O-])[O-])C}}
+
{{#set: right end position=1309}}
−
{{#set: inchi key=InChIKey=KTGSDHZXAKCYHM-LSTWDCEHSA-L}}
+
{{#set: centisome position=0.57366365   }}
−
{{#set: common name=ω-saturated C55 dolichol phosphate}}
+
{{#set: reaction associated=1-PHOSPHATIDYLINOSITOL-KINASE-RXN}}
−
{{#set: molecular weight=849.311   }}
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
−
{{#set: common name=ω-saturated dolichol-11 phosphate}}
+
−
{{#set: consumed by=RXN-16602}}
+

Revision as of 18:04, 18 March 2018

Gene Tiso_gene_17238

  • left end position:
    • 22
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 1309
  • centisome position:
    • 0.57366365
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=R00939&oldid=21755"