Difference between revisions of "BUTANOL"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ABor ABor] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-Aminobutyraldehyde:NAD+ oxidoreduct...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] == * smiles: ** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-] * inchi key: ** InChIKey...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ABor ABor] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19489 CPD-19489] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
 
* common name:
 
* common name:
−
** 4-Aminobutyraldehyde:NAD+ oxidoreductase
+
** 3-isopropyl-8-(methylthio)-2-oxooctanoate
 +
* molecular weight:
 +
** 246.278   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-18205]]
−
** 1.0 [[4-AMINO-BUTYRALDEHYDE]][m] '''+''' 1.0 [[WATER]][m] '''+''' 1.0 [[NADP]][m] '''=>''' 1.0 [[NADPH]][m] '''+''' 2.0 [[PROTON]][m] '''+''' 1.0 [[4-AMINO-BUTYRATE]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 4-aminobutanal[m] '''+''' 1.0 H2O[m] '''+''' 1.0 NADP+[m] '''=>''' 1.0 NADPH[m] '''+''' 2.0 H+[m] '''+''' 1.0 4-aminobutanoate[m]
+
* [[RXN-18204]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3513]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: smiles=CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]}}
−
{{#set: common name=4-Aminobutyraldehyde:NAD+ oxidoreductase}}
+
{{#set: inchi key=InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L}}
−
{{#set: gene associated=Tiso_gene_3513}}
+
{{#set: common name=3-isopropyl-8-(methylthio)-2-oxooctanoate}}
−
{{#set: in pathway=}}
+
{{#set: molecular weight=246.278    }}
−
{{#set: reconstruction category=orthology}}
+
{{#set: consumed by=RXN-18205}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: reversible reaction associated=RXN-18204}}
−
{{#set: reconstruction source=creinhardtii}}
+

Revision as of 19:05, 18 March 2018

Metabolite CPD-19489

  • smiles:
    • CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-]
  • inchi key:
    • InChIKey=YOBCOUZBIFVTFN-UHFFFAOYSA-L
  • common name:
    • 3-isopropyl-8-(methylthio)-2-oxooctanoate
  • molecular weight:
    • 246.278
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CSCCCCCC(C(=O)C(=O)[O-])C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=BUTANOL&oldid=21797"