Difference between revisions of "CPD-15977"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-5...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUTARYL-COA GLUTARYL-COA] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168] ==
−
* smiles:
+
* taxonomic range:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-58024 TAX-58024]
−
* inchi key:
+
−
** InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I
+
 
* common name:
 
* common name:
−
** glutaryl-CoA
+
** ferulate and sinapate biosynthesis
−
* molecular weight:
+
−
** 876.595   
+
 
* Synonym(s):
 
* Synonym(s):
−
** glutaryl-coenzyme A
 
−
** 4-carboxybutanoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''2''' reactions found over '''4''' reactions in the full pathway
−
* [[2-KETO-ADIPATE-DEHYDROG-RXN]]
+
* [[RXN-1143]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
−
* [[RXN-8032]]
+
*** [[Tiso_gene_18971]]
 +
*** [[Tiso_gene_18257]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-8014]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3513]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1142 RXN-1142]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-1241 RXN-1241]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
* ARACYC:
−
** [http://www.genome.jp/dbget-bin/www_bget?C00527 C00527]
+
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5168 PWY-5168]
−
* CHEBI:
+
{{#set: taxonomic range=TAX-58024}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57378 57378]
+
{{#set: common name=ferulate and sinapate biosynthesis}}
−
* METABOLIGHTS : MTBLC57378
+
{{#set: reaction found=2}}
−
* PUBCHEM:
+
{{#set: total reaction=4}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266604 45266604]
+
{{#set: completion rate=50.0}}
−
* HMDB : HMDB01339
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CCCC(=O)[O-])=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=SYKWLIJQEHRDNH-CKRMAKSASA-I}}
+
−
{{#set: common name=glutaryl-CoA}}
+
−
{{#set: molecular weight=876.595    }}
+
−
{{#set: common name=glutaryl-coenzyme A|4-carboxybutanoyl-CoA}}
+
−
{{#set: produced by=2-KETO-ADIPATE-DEHYDROG-RXN}}
+
−
{{#set: consumed or produced by=RXN-8032}}
+

Revision as of 18:05, 18 March 2018

Pathway PWY-5168

  • taxonomic range:
  • common name:
    • ferulate and sinapate biosynthesis
  • Synonym(s):

Reaction(s) found

2 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15977&oldid=21801"