Difference between revisions of "PWY-6605"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1) * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_8483 == * left end position: ** 1747 * transcription direction: ** POSITIVE * right end position: ** 3675 * centisome position: ** 9.833943...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+
== Gene Tiso_gene_8483 ==
−
* smiles:
+
* left end position:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
** 1747
−
* inchi key:
+
* transcription direction:
−
** InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 1D-myo-inositol 5-monophosphate
+
** 3675
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 9.833943    
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 5-monophosphate
 
−
** Ins(5)P1
 
−
** 1D-myo-inositol 5-phosphate
 
−
** Ins(5)P
 
−
** Ins5P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10953]]
+
* [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
{{#set: left end position=1747}}
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-KXXVROSKSA-L}}
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: common name=1D-myo-inositol 5-monophosphate}}
+
{{#set: right end position=3675}}
−
{{#set: molecular weight=258.121   }}
+
{{#set: centisome position=9.833943   }}
−
{{#set: common name=D-myo-inositol 5-monophosphate|Ins(5)P1|1D-myo-inositol 5-phosphate|Ins(5)P|Ins5P}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: consumed by=RXN-10953}}
+
{{#set: pathway associated=PWY-7511}}

Revision as of 18:05, 18 March 2018

Gene Tiso_gene_8483

  • left end position:
    • 1747
  • transcription direction:
    • POSITIVE
  • right end position:
    • 3675
  • centisome position:
    • 9.833943
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6605&oldid=21857"