Difference between revisions of "GLYCOLATEMET-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13913 CPD-13913] == * smiles: ** C(O)C1(OC(=O)C(O)(C(=O)[O-])C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_2034 == * left end position: ** 9085 * transcription direction: ** NEGATIVE * right end position: ** 13886 * centisome position: ** 43.7052...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2034 == |
− | * | + | * left end position: |
− | ** | + | ** 9085 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 13886 |
− | * | + | * centisome position: |
− | ** | + | ** 43.7052 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | * [[RXN | + | * [[3.1.3.16-RXN]] |
− | + | ** in-silico_annotation | |
− | * | + | ***automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=9085}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | {{#set: | + | {{#set: right end position=13886}} |
− | {{#set: | + | {{#set: centisome position=43.7052 }} |
− | {{#set: | + | {{#set: reaction associated=3.1.3.16-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:06, 18 March 2018
Gene Tiso_gene_2034
- left end position:
- 9085
- transcription direction:
- NEGATIVE
- right end position:
- 13886
- centisome position:
- 43.7052
- Synonym(s):
Reactions associated
- 3.1.3.16-RXN
- in-silico_annotation
- automated-name-match
- in-silico_annotation