Difference between revisions of "1.1.1.274-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLESTEROL CHOLESTEROL] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FE2GTPabc FE2GTPabc] == * direction: ** LEFT-TO-RIGHT * common name: ** ferrous iron uptake (GTP-de...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLESTEROL CHOLESTEROL] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FE2GTPabc FE2GTPabc] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HVYWMOMLDIMFJA-DPAQBDIFSA-N
+
 
* common name:
 
* common name:
−
** cholesterol
+
** ferrous iron uptake (GTP-dependent), plasma membrane
−
* molecular weight:
+
−
** 386.66   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5-cholestene-3β-ol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-12693]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[WATER]][c] '''+''' 1.0 [[GTP]][c] '''+''' 1.0 [[FE+2]][e] '''=>''' 1.0 [[Pi]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[FE+2]][c] '''+''' 1.0 [[GDP]][c]
−
* [[RXN66-323]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 H2O[c] '''+''' 1.0 GTP[c] '''+''' 1.0 Fe2+[e] '''=>''' 1.0 phosphate[c] '''+''' 1.0 H+[c] '''+''' 1.0 Fe2+[c] '''+''' 1.0 GDP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_2686]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 57-88-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB04540
+
{{#set: common name=ferrous iron uptake (GTP-dependent), plasma membrane}}
−
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_2686}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5997 5997]
+
{{#set: in pathway=}}
−
* HMDB : HMDB00067
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00187 C00187]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5775.html 5775]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16113 16113]
+
−
* METABOLIGHTS : MTBLC16113
+
−
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=HVYWMOMLDIMFJA-DPAQBDIFSA-N}}
+
−
{{#set: common name=cholesterol}}
+
−
{{#set: molecular weight=386.66    }}
+
−
{{#set: common name=5-cholestene-3β-ol}}
+
−
{{#set: consumed by=RXN-12693}}
+
−
{{#set: produced by=RXN66-323}}
+

Revision as of 18:06, 18 March 2018

Reaction FE2GTPabc

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ferrous iron uptake (GTP-dependent), plasma membrane
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H2O[c] + 1.0 GTP[c] + 1.0 Fe2+[e] => 1.0 phosphate[c] + 1.0 H+[c] + 1.0 Fe2+[c] + 1.0 GDP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.1.1.274-RXN&oldid=22019"