Difference between revisions of "Tiso gene 9166"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.151-RXN 2.4.1.151-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.151-RXN 2.4.1.151-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/2.4.1.87 EC-2.4.1.87] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPD-14553]][c] '''+''' 1 [[B-Gal-14-NacGlc-R]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL]][c] |
− | == | + | * With common name(s): |
+ | ** 1 UDP-α-D-galactose[c] '''+''' 1 a type 2 histo-blood group antigen precursor disaccharide[c] '''=>''' 1 UDP[c] '''+''' 1 H+[c] '''+''' 1 an α-D-galactosyl-(1,3)-β-D-galactosyl-(1,4)-N-acetyl-D-glucosaminyl-R[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_13589]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7434]], terminal O-glycans residues modification (via type 2 precursor disaccharide): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7434 PWY-7434] | ||
+ | ** '''1''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13013 13013] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02791 R02791] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/Q28855 Q28855] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | {{#set: | + | {{#set: ec number=EC-2.4.1.87}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_13589}} |
− | {{#set: | + | {{#set: in pathway=PWY-7434}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
Revision as of 19:07, 18 March 2018
Contents
Reaction 2.4.1.151-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CPD-14553[c] + 1 B-Gal-14-NacGlc-R[c] => 1 UDP[c] + 1 PROTON[c] + 1 ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL[c]
- With common name(s):
- 1 UDP-α-D-galactose[c] + 1 a type 2 histo-blood group antigen precursor disaccharide[c] => 1 UDP[c] + 1 H+[c] + 1 an α-D-galactosyl-(1,3)-β-D-galactosyl-(1,4)-N-acetyl-D-glucosaminyl-R[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-7434, terminal O-glycans residues modification (via type 2 precursor disaccharide): PWY-7434
- 1 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links