Difference between revisions of "Heparan-NAc-Glc-6S"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * smiles: ** C1(=NC(C([O-])=O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxycerotyl-[acp] dehy...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10061 RXN-10061] ==
* smiles:
+
* direction:
** C1(=NC(C([O-])=O)CC(O)1)
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
+
 
* common name:
 
* common name:
** (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate
+
** 3-hydroxycerotyl-[acp] dehydrase
* molecular weight:
+
* ec number:
** 128.107   
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
** L-Δ1-pyrroline 3-hydroxy-5-carboxylate
 
** L-1pyrroline-3-hydroxy-5-carboxylate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN66-546]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[R-3-hydroxycerotoyl-ACPs]][c] '''=>''' 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''+''' 1 [[WATER]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
* [[HYDROXYPYRROLINEDEH-RXN]]
+
** 1 a (3R)-3-hydroxycerotoyl-[acp][c] '''=>''' 1 a trans-hexacos-2-enoyl-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_6884]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
 +
** '''8''' reactions found over '''12''' reactions in the full pathway
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300]
+
{{#set: common name=3-hydroxycerotyl-[acp] dehydrase}}
* CHEBI:
+
{{#set: ec number=EC-4.2.1.59}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612]
+
{{#set: gene associated=Tiso_gene_6884}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6113|PWYG-321}}
** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281]
+
{{#set: reconstruction category=annotation}}
* HMDB : HMDB01369
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
{{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}}
+
{{#set: common name=(3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate}}
+
{{#set: molecular weight=128.107    }}
+
{{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1pyrroline-3-hydroxy-5-carboxylate}}
+
{{#set: consumed by=RXN66-546}}
+
{{#set: consumed or produced by=HYDROXYPYRROLINEDEH-RXN}}
+

Revision as of 19:07, 18 March 2018

Reaction RXN-10061

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxycerotyl-[acp] dehydrase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6113, superpathway of mycolate biosynthesis: PWY-6113
    • 8 reactions found over 12 reactions in the full pathway
  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"3-hydroxycerotyl-[acp] dehydrase" cannot be used as a page name in this wiki.