Difference between revisions of "THRDLCTCAT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** f...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATESYNTH-RXN DIHYDROFOLATESYNTH-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** folylpolyglutamate_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/6.3.2.12 EC-6.3.2.12] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[7-8-DIHYDROPTEROATE]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[DIHYDROFOLATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] | |
− | + | * With common name(s): | |
− | + | ** 1 7,8-dihydropteroate[c] '''+''' 1 L-glutamate[c] '''+''' 1 ATP[c] '''=>''' 1 phosphate[c] '''+''' 1 7,8-dihydrofolate monoglutamate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] | |
− | * [[ | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * | + | * [[Tiso_gene_15942]] |
− | * [[ | + | ** IN-SILICO_ANNOTATION |
− | * [[ | + | ***AUTOMATED-NAME-MATCH |
− | * [[ | + | * [[Tiso_gene_92]] |
− | * [[ | + | ** [[pantograph]]-[[synechocystis]] |
− | * [[ | + | == Pathways == |
− | * [[ | + | * [[PWY-6614]], tetrahydrofolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6614 PWY-6614] |
− | + | ** '''3''' reactions found over '''3''' reactions in the full pathway | |
− | * [[ | + | == Reconstruction information == |
− | * [[ | + | * Category: [[orthology]] |
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23584 23584] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02237 R02237] |
− | + | * UNIPROT: | |
− | * LIGAND- | + | ** [http://www.uniprot.org/uniprot/Q9JVC6 Q9JVC6] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/P43775 P43775] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PNK6 Q9PNK6] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q50990 Q50990] |
− | * | + | ** [http://www.uniprot.org/uniprot/P08192 P08192] |
− | ** [http://www. | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | * | + | {{#set: common name=folylpolyglutamate_synthase}} |
− | {{#set: | + | {{#set: ec number=EC-6.3.2.12}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_15942|Tiso_gene_92}} |
− | {{#set: | + | {{#set: in pathway=PWY-6614}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-synechocystis}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:08, 18 March 2018
Contents
Reaction DIHYDROFOLATESYNTH-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- folylpolyglutamate_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 7-8-DIHYDROPTEROATE[c] + 1 GLT[c] + 1 ATP[c] => 1 Pi[c] + 1 DIHYDROFOLATE[c] + 1 PROTON[c] + 1 ADP[c]
- With common name(s):
- 1 7,8-dihydropteroate[c] + 1 L-glutamate[c] + 1 ATP[c] => 1 phosphate[c] + 1 7,8-dihydrofolate monoglutamate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Tiso_gene_15942
- IN-SILICO_ANNOTATION
- AUTOMATED-NAME-MATCH
- IN-SILICO_ANNOTATION
- Tiso_gene_92
Pathways
- PWY-6614, tetrahydrofolate biosynthesis: PWY-6614
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links