Difference between revisions of "RXN-8001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6268 PWY-6268] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6268 PWY-6268] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
− | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** adenosylcobalamin salvage from cobalamin |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** vitamin B12 biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''1''' reactions in the full pathway |
− | * [[ | + | * [[COBALADENOSYLTRANS-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_6190]] |
− | == Reaction(s) | + | ** 2 reconstruction source(s) associated: |
− | + | *** [[annotation-in-silico_annotation]] | |
− | + | *** [[orthology-esiliculosus]] | |
− | + | == Reaction(s) not found == | |
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6268 PWY-6268] | |
− | + | {{#set: taxonomic range=TAX-2157}} | |
− | ** [http:// | + | {{#set: taxonomic range=TAX-2}} |
− | + | {{#set: common name=adenosylcobalamin salvage from cobalamin}} | |
− | + | {{#set: common name=vitamin B12 biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=1}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:08, 18 March 2018
Pathway PWY-6268
- taxonomic range:
- common name:
- adenosylcobalamin salvage from cobalamin
- Synonym(s):
- vitamin B12 biosynthesis
Reaction(s) found
1 reactions found over 1 reactions in the full pathway
- COBALADENOSYLTRANS-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: