Difference between revisions of "L-HISTIDINOL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYSTINE CYSTINE] == * smiles: ** C(C(C(=O)[O-])[N+])SSCC(C([O-])=O)[N+] * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9844 RXN-9844] == * direction: ** LEFT-TO-RIGHT * common name: ** (25R)-3α,7α-dihyd...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9844 RXN-9844] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** (25R)-3α,7α-dihydroxy-5β-cholestan-26-al 26-hydroxylase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 2 [[Reduced-adrenal-ferredoxins]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-10587]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-1834]][c] '''+''' 2 [[Oxidized-adrenal-ferredoxins]][c] '''+''' 1 [[WATER]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 2 a reduced adrenodoxin[c] '''+''' 1 oxygen[c] '''+''' 1 (25R)-3α,7α-dihydroxy-5β-cholestan-26-al[c] '''+''' 1 H+[c] '''=>''' 1 (25R)-3α,7α-dihydroxy-5-β-cholestanate[c] '''+''' 2 an oxidized adrenodoxin[c] '''+''' 1 H2O[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_7322]] | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6061]], bile acid biosynthesis, neutral pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6061 PWY-6061] | ||
+ | ** '''3''' reactions found over '''29''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04506 R04506] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=(25R)-3α,7α-dihydroxy-5β-cholestan-26-al 26-hydroxylase}} | |
− | * LIGAND- | + | {{#set: gene associated=Tiso_gene_7322}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-6061}} |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:09, 18 March 2018
Contents
Reaction RXN-9844
- direction:
- LEFT-TO-RIGHT
- common name:
- (25R)-3α,7α-dihydroxy-5β-cholestan-26-al 26-hydroxylase
- Synonym(s):
Reaction Formula
- With identifiers:
- 2 Reduced-adrenal-ferredoxins[c] + 1 OXYGEN-MOLECULE[c] + 1 CPD-10587[c] + 1 PROTON[c] => 1 CPD-1834[c] + 2 Oxidized-adrenal-ferredoxins[c] + 1 WATER[c]
- With common name(s):
- 2 a reduced adrenodoxin[c] + 1 oxygen[c] + 1 (25R)-3α,7α-dihydroxy-5β-cholestan-26-al[c] + 1 H+[c] => 1 (25R)-3α,7α-dihydroxy-5-β-cholestanate[c] + 2 an oxidized adrenodoxin[c] + 1 H2O[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6061, bile acid biosynthesis, neutral pathway: PWY-6061
- 3 reactions found over 29 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- LIGAND-RXN: