Difference between revisions of "2-HYDROXYPHYTANOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(...")
(Created page with "Category:Gene == Gene Tiso_gene_10324 == * left end position: ** 1194 * transcription direction: ** POSITIVE * right end position: ** 2763 * centisome position: ** 13.8290...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10337 CPD-10337] ==
+
== Gene Tiso_gene_10324 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 1194
−
* common name:
+
* transcription direction:
−
** chlorophyll c2
+
** POSITIVE
−
* molecular weight:
+
* right end position:
−
** 606.919    
+
** 2763
 +
* centisome position:
 +
** 13.829048    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.4.21.92-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** experimental_annotation
−
* [[RXN-17487]]
+
***automated-name-match
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1194}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244281 25244281]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=2763}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=38203 38203]
+
{{#set: centisome position=13.829048   }}
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)=C(C=CC(=O)[O-])C5(=N([Mg]36(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: reaction associated=3.4.21.92-RXN}}
−
{{#set: common name=chlorophyll c2}}
+
−
{{#set: molecular weight=606.919   }}
+
−
{{#set: consumed or produced by=RXN-17487}}
+

Revision as of 19:09, 18 March 2018

Gene Tiso_gene_10324

  • left end position:
    • 1194
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2763
  • centisome position:
    • 13.829048
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-HYDROXYPHYTANOYL-COA&oldid=22324"