Difference between revisions of "Tiso gene 9590"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] == * smiles: ** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCUR1PUT GLCUR1PUT] == * direction: ** LEFT-TO-RIGHT * common name: ** UTP:1-phospho-alpha-D-glucu...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11752 CPD-11752] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLCUR1PUT GLCUR1PUT] ==
−
* smiles:
+
* direction:
−
** COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N
+
 
* common name:
 
* common name:
−
** rebeccamycin
+
** UTP:1-phospho-alpha-D-glucuronate uridylyltransferase
−
* molecular weight:
+
−
** 570.385   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10847]]
+
** 1.0 [[UTP]][c] '''+''' 1.0 [[CPD-510]][c] '''=>''' 1.0 [[PPI]][c] '''+''' 1.0 [[UDP-GLUCURONATE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 UTP[c] '''+''' 1.0 α-D-glucuronate 1-phosphate[c] '''=>''' 1.0 diphosphate[c] '''+''' 1.0 UDP-α-D-glucuronate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_11401]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C19701 C19701]
+
{{#set: common name=UTP:1-phospho-alpha-D-glucuronate uridylyltransferase}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_11401}}
−
** [http://www.chemspider.com/Chemical-Structure.65891.html 65891]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=135511 135511]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=73110 73110]
+
−
{{#set: smiles=COC1(C(CO)OC(C(C1O)O)N7(C2(C(=CC=CC=2C6(C3(C(NC(C=3C5(C4(C=CC=C(C=4NC=5C=67)Cl)))=O)=O)))Cl)))}}
+
−
{{#set: inchi key=InChIKey=QEHOIJJIZXRMAN-QZQSLCQPSA-N}}
+
−
{{#set: common name=rebeccamycin}}
+
−
{{#set: molecular weight=570.385    }}
+
−
{{#set: produced by=RXN-10847}}
+

Revision as of 18:09, 18 March 2018

Reaction GLCUR1PUT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UTP:1-phospho-alpha-D-glucuronate uridylyltransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 UTP[c] + 1.0 α-D-glucuronate 1-phosphate[c] => 1.0 diphosphate[c] + 1.0 UDP-α-D-glucuronate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9590&oldid=22337"