Difference between revisions of "L-GLUTAMATE-5-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14184 == * Synonym(s): == Reactions associated == * BIOTINLIG-RXN ** in-silico_annotation ***ec-number * RXN0-7192 ** in-silico_an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * smiles: ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) * inchi key...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == |
| + | * smiles: | ||
| + | ** C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+]) | ||
| + | * inchi key: | ||
| + | ** InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M | ||
| + | * common name: | ||
| + | ** L-histidinol-phosphate | ||
| + | * molecular weight: | ||
| + | ** 220.144 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** histidinol-P | ||
| + | ** L-histidinol-p | ||
| + | ** histidinol-phosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[HISTIDPHOS-RXN]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[HISTAMINOTRANS-RXN]] | |
| − | * [[ | + | == Reaction(s) of unknown directionality == |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 25679-93-0 |
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791964 49791964] | ||
| + | * KNAPSACK : C00007480 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01100 C01100] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57980 57980] | ||
| + | * BIGG : hisp | ||
| + | {{#set: smiles=C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])}} | ||
| + | {{#set: inchi key=InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M}} | ||
| + | {{#set: common name=L-histidinol-phosphate}} | ||
| + | {{#set: molecular weight=220.144 }} | ||
| + | {{#set: common name=histidinol-P|L-histidinol-p|histidinol-phosphate}} | ||
| + | {{#set: consumed by=HISTIDPHOS-RXN}} | ||
| + | {{#set: produced by=HISTAMINOTRANS-RXN}} | ||
Revision as of 18:09, 18 March 2018
Contents
Metabolite L-HISTIDINOL-P
- smiles:
- C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])
- inchi key:
- InChIKey=CWNDERHTHMWBSI-YFKPBYRVSA-M
- common name:
- L-histidinol-phosphate
- molecular weight:
- 220.144
- Synonym(s):
- histidinol-P
- L-histidinol-p
- histidinol-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC(COP([O-])(=O)[O-])[N+])" cannot be used as a page name in this wiki.
