Difference between revisions of "PWY-7277"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C1(NC=NC=1CC([CH]=O)[N+]) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O |
* common name: | * common name: | ||
| − | ** | + | ** histidinal |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 140.164 |
* Synonym(s): | * Synonym(s): | ||
| + | ** L-histidinal | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[HISTALDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[HISTOLDEHYD-RXN]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283] |
| − | * HMDB : | + | * CHEBI: |
| − | {{#set: smiles= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802] |
| − | {{#set: inchi key=InChIKey= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929] |
| − | {{#set: molecular weight= | + | * HMDB : HMDB12234 |
| − | {{#set: | + | {{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}} |
| + | {{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=histidinal}} | ||
| + | {{#set: molecular weight=140.164 }} | ||
| + | {{#set: common name=L-histidinal}} | ||
| + | {{#set: consumed by=HISTALDEHYD-RXN}} | ||
| + | {{#set: reversible reaction associated=HISTOLDEHYD-RXN}} | ||
Revision as of 18:09, 18 March 2018
Contents
Metabolite HISTIDINAL
- smiles:
- C1(NC=NC=1CC([CH]=O)[N+])
- inchi key:
- InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
- common name:
- histidinal
- molecular weight:
- 140.164
- Synonym(s):
- L-histidinal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.
