Difference between revisions of "PWY-6446"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * inchi key: ** InChIKey=VYOIE...")
(Created page with "Category:Gene == Gene Tiso_gene_6390 == * left end position: ** 17027 * transcription direction: ** NEGATIVE * right end position: ** 19778 * centisome position: ** 85.990...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] ==
+
== Gene Tiso_gene_6390 ==
−
* smiles:
+
* left end position:
−
** C1(NC=NC=1CC([CH]=O)[N+])
+
** 17027
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** histidinal
+
** 19778
−
* molecular weight:
+
* centisome position:
−
** 140.164    
+
** 85.99061    
 
* Synonym(s):
 
* Synonym(s):
−
** L-histidinal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[HISTALDEHYD-RXN]]
+
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[HISTOLDEHYD-RXN]]
+
** [[pantograph]]-[[esiliculosus]]
 +
* [[RXN-16648]]
 +
** [[pantograph]]-[[synechocystis]]
 +
== Pathways associated ==
 +
* [[PWY-7817]]
 +
* [[PWY-7666]]
 +
* [[PWY-1001]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=17027}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=19778}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64802 64802]
+
{{#set: centisome position=85.99061   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=CELLULOSE-SYNTHASE-UDP-FORMING-RXN|RXN-16648}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929]
+
{{#set: pathway associated=PWY-7817|PWY-7666|PWY-1001}}
−
* HMDB : HMDB12234
+
−
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}}
+
−
{{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}}
+
−
{{#set: common name=histidinal}}
+
−
{{#set: molecular weight=140.164   }}
+
−
{{#set: common name=L-histidinal}}
+
−
{{#set: consumed by=HISTALDEHYD-RXN}}
+
−
{{#set: consumed or produced by=HISTOLDEHYD-RXN}}
+

Revision as of 19:10, 18 March 2018

Gene Tiso_gene_6390

  • left end position:
    • 17027
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 19778
  • centisome position:
    • 85.99061
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6446&oldid=22392"