Difference between revisions of "Tiso gene 17625"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_4468 == * Synonym(s): == Reactions associated == * PANTETHEINE-KINASE-RXN ** pantograph-creinhardtii * [[PANTOTHENATE-KIN-RXN]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == * smiles: ** CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-N-ACETYLMURAMATE UDP-N-ACETYLMURAMATE] == |
+ | * smiles: | ||
+ | ** CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3) | ||
+ | * inchi key: | ||
+ | ** InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K | ||
+ | * common name: | ||
+ | ** UDP-N-acetyl-α-D-muramate | ||
+ | * molecular weight: | ||
+ | ** 676.397 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** uridine diphosphate N-acetylmuramic acid | ||
+ | ** UDP-N-acetylmuramic acid | ||
+ | ** UDP-N-acetyl-D-muramate | ||
+ | ** UDP-MurNAc | ||
+ | ** UDP-N-acetylmuramoyl | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[UDPNACETYLMURAMATEDEHYDROG-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01050 C01050] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70757 70757] | ||
+ | * BIGG : uamr | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24772978 24772978] | ||
+ | * HMDB : HMDB11720 | ||
+ | {{#set: smiles=CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)}} | ||
+ | {{#set: inchi key=InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K}} | ||
+ | {{#set: common name=UDP-N-acetyl-α-D-muramate}} | ||
+ | {{#set: molecular weight=676.397 }} | ||
+ | {{#set: common name=uridine diphosphate N-acetylmuramic acid|UDP-N-acetylmuramic acid|UDP-N-acetyl-D-muramate|UDP-MurNAc|UDP-N-acetylmuramoyl}} | ||
+ | {{#set: produced by=UDPNACETYLMURAMATEDEHYDROG-RXN}} |
Revision as of 19:10, 18 March 2018
Contents
Metabolite UDP-N-ACETYLMURAMATE
- smiles:
- CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)
- inchi key:
- InChIKey=NQBRVZNDBBMBLJ-MQTLHLSBSA-K
- common name:
- UDP-N-acetyl-α-D-muramate
- molecular weight:
- 676.397
- Synonym(s):
- uridine diphosphate N-acetylmuramic acid
- UDP-N-acetylmuramic acid
- UDP-N-acetyl-D-muramate
- UDP-MurNAc
- UDP-N-acetylmuramoyl
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C([O-])=O)OC3(C(O)C(CO)OC(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))C(NC(C)=O)3)" cannot be used as a page name in this wiki.