Difference between revisions of "METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACYL-SN-GLYCEROL-3P ACYL-SN-GLYCEROL-3P] == * common name: ** a 1-acyl-sn-glycerol 3-phosphate...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == * smiles: ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O * inchi key...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18011 CPD-18011] == |
+ | * smiles: | ||
+ | ** C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O | ||
+ | * inchi key: | ||
+ | ** InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate |
+ | * molecular weight: | ||
+ | ** 332.2 | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[2.4.1.213-RXN]] |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658883 90658883] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87089 87089] |
− | {{#set: | + | {{#set: smiles=C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O}} |
+ | {{#set: inchi key=InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L}} | ||
+ | {{#set: common name=2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate}} | ||
+ | {{#set: molecular weight=332.2 }} | ||
+ | {{#set: reversible reaction associated=2.4.1.213-RXN}} |
Revision as of 18:10, 18 March 2018
Contents
Metabolite CPD-18011
- smiles:
- C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O
- inchi key:
- InChIKey=PLJAVYDLNJODGD-NZJLWHDDSA-L
- common name:
- 2-O-(α-D-glucopyranosyl)-sn-glycerol 3-phosphate
- molecular weight:
- 332.2
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(OC1(OC(C(O)C(C1O)O)CO))COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.