Difference between revisions of "PWY-5076"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...")
(Created page with "Category:Gene == Gene Tiso_gene_8396 == * left end position: ** 1088 * transcription direction: ** NEGATIVE * right end position: ** 5351 * centisome position: ** 10.56926...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
+
== Gene Tiso_gene_8396 ==
−
* smiles:
+
* left end position:
−
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
+
** 1088
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 6,7-dehydrobaicalein
+
** 5351
−
* molecular weight:
+
* centisome position:
−
** 268.225    
+
** 10.569264    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[RNA-LIGASE-ATP-RXN]]
−
* [[RXN-14240]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
* [[RXN-17925]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17926]]
 +
** in-silico_annotation
 +
***ec-number
 +
* [[RXN-17927]]
 +
** in-silico_annotation
 +
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1088}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
+
{{#set: right end position=5351}}
−
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
+
{{#set: centisome position=10.569264   }}
−
{{#set: common name=6,7-dehydrobaicalein}}
+
{{#set: reaction associated=RNA-LIGASE-ATP-RXN|RXN-17925|RXN-17926|RXN-17927}}
−
{{#set: molecular weight=268.225   }}
+
−
{{#set: produced by=RXN-14240}}
+

Revision as of 18:11, 18 March 2018

Gene Tiso_gene_8396

  • left end position:
    • 1088
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 5351
  • centisome position:
    • 10.569264
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-5076&oldid=22491"