Difference between revisions of "RXN-17784"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] == * smiles: ** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2)) * inchi key: **...")
(Created page with "Category:Gene == Gene Tiso_gene_7035 == * left end position: ** 10183 * transcription direction: ** POSITIVE * right end position: ** 11195 * centisome position: ** 87.928...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-882 CPD0-882] ==
+
== Gene Tiso_gene_7035 ==
−
* smiles:
+
* left end position:
−
** CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))
+
** 10183
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 1,6-anhydro-N-acetyl-β-muramate
+
** 11195
−
* molecular weight:
+
* centisome position:
−
** 274.25    
+
** 87.928505    
 
* Synonym(s):
 
* Synonym(s):
−
** 1,6-anhMurNAc
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.16-RXN]]
−
* [[RXN0-5226]]
+
** experimental_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=10183}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658592 90658592]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: right end position=11195}}
−
** [http://www.chemspider.com/Chemical-Structure.4883322.html 4883322]
+
{{#set: centisome position=87.928505   }}
−
* CHEBI:
+
{{#set: reaction associated=3.1.3.16-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58690 58690]
+
−
* BIGG : anhm
+
−
{{#set: smiles=CC(C([O-])=O)OC2(C(O)C1(COC(O1)C(NC(C)=O)2))}}
+
−
{{#set: inchi key=InChIKey=ZFEGYUMHFZOYIY-MKFCKLDKSA-M}}
+
−
{{#set: common name=1,6-anhydro-N-acetyl-β-muramate}}
+
−
{{#set: molecular weight=274.25   }}
+
−
{{#set: common name=1,6-anhMurNAc}}
+
−
{{#set: produced by=RXN0-5226}}
+

Revision as of 18:11, 18 March 2018

Gene Tiso_gene_7035

  • left end position:
    • 10183
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11195
  • centisome position:
    • 87.928505
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17784&oldid=22559"