Difference between revisions of "Tiso gene 3939"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] == * smiles: ** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2) * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=UDPNACETYLGALSYN-PWY UDPNACETYLGALSYN-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAG...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17045 CPD-17045] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=UDPNACETYLGALSYN-PWY UDPNACETYLGALSYN-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N
+
 
* common name:
 
* common name:
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine
+
** UDP-N-acetyl-D-glucosamine biosynthesis II
−
* molecular weight:
+
−
** 266.253   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP
+
** UDP-N-acetylgalactosamine biosynthesis
−
** 3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-15680]]
+
'''4''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[GLUCOSAMINEPNACETYLTRANS-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_9051]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-esiliculosus]]
 +
* [[NAG1P-URIDYLTRANS-RXN]]
 +
** 4 associated gene(s):
 +
*** [[Tiso_gene_6457]]
 +
*** [[Tiso_gene_19372]]
 +
*** [[Tiso_gene_6459]]
 +
*** [[Tiso_gene_6458]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[PHOSACETYLGLUCOSAMINEMUT-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_13230]]
 +
*** [[Tiso_gene_13231]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-experimental_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659074 90659074]
+
{{#set: common name=UDP-N-acetyl-D-glucosamine biosynthesis II}}
−
{{#set: smiles=C(O)C2(O)(NC(=O)C(O)(CC1(=CC=CC=C1))NC(=O)2)}}
+
{{#set: common name=UDP-N-acetylgalactosamine biosynthesis}}
−
{{#set: inchi key=InChIKey=PXYPZMRMTKVYSM-VXGBXAGGSA-N}}
+
{{#set: reaction found=4}}
−
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: total reaction=4}}
−
{{#set: molecular weight=266.253    }}
+
{{#set: completion rate=100.0}}
−
{{#set: common name=3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)-DKP|3-benzyl-3,6-dihydroxy-6-(hydroxymethyl)piperazine-2,5-dione}}
+
−
{{#set: consumed by=RXN-15680}}
+

Revision as of 18:12, 18 March 2018

Pathway UDPNACETYLGALSYN-PWY

  • taxonomic range:
  • common name:
    • UDP-N-acetyl-D-glucosamine biosynthesis II
  • Synonym(s):
    • UDP-N-acetylgalactosamine biosynthesis

Reaction(s) found

4 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_3939&oldid=22633"