Difference between revisions of "CREATINE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-881 RXN1G-881] == * direction: ** LEFT-TO-RIGHT * common name: ** cis-delta17-3-oxo-C36:1-[ac...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C * inchi key: ** InCh...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRISTANATE PRISTANATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C |
+ | * inchi key: | ||
+ | ** InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** pristanate |
− | * | + | * molecular weight: |
− | ** | + | ** 297.5 |
* Synonym(s): | * Synonym(s): | ||
+ | ** pristanic-acid | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN66-484]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849056 20849056] | |
− | + | * CHEMSPIDER: | |
− | + | ** [http://www.chemspider.com/Chemical-Structure.20171482.html 20171482] | |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77268 77268] | |
− | {{#set: | + | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: common name=pristanate}} |
− | {{#set: | + | {{#set: molecular weight=297.5 }} |
− | {{#set: | + | {{#set: common name=pristanic-acid}} |
+ | {{#set: consumed by=RXN66-484}} |
Revision as of 18:12, 18 March 2018
Contents
Metabolite PRISTANATE
- smiles:
- CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C
- inchi key:
- InChIKey=PAHGJZDQXIOYTH-UHFFFAOYSA-M
- common name:
- pristanate
- molecular weight:
- 297.5
- Synonym(s):
- pristanic-acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C([O-])=O)C)C)C" cannot be used as a page name in this wiki.