Difference between revisions of "Tiso gene 4620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == * smiles: ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11482 RXN-11482] ==
−
* smiles:
+
* direction:
−
** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
−
* common name:
+
−
** (S)-2,3-dihydrodipicolinate
+
−
* molecular weight:
+
−
** 167.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-di-H-dipicolinate
 
−
** L-2,3-dihydrodipicolinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[R02292]]
+
** 1 [[Enoylpimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Pimeloyl-ACP-methyl-esters]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 an enoylpimeloyl-[acp] methyl ester[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a pimeloyl-[acp] methyl ester[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_10778]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6519]], 8-amino-7-oxononanoate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6519 PWY-6519]
 +
** '''9''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460228 5460228]
+
{{#set: ec number=EC-1.3.1.9}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_10778}}
−
** [http://www.chemspider.com/Chemical-Structure.4573840.html 4573840]
+
{{#set: in pathway=PWY-6519}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30620 30620]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03340 C03340]
+
−
* HMDB : HMDB12247
+
−
{{#set: smiles=C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L}}
+
−
{{#set: common name=(S)-2,3-dihydrodipicolinate}}
+
−
{{#set: molecular weight=167.121    }}
+
−
{{#set: common name=2,3-di-H-dipicolinate|L-2,3-dihydrodipicolinate}}
+
−
{{#set: produced by=R02292}}
+

Revision as of 18:12, 18 March 2018

Reaction RXN-11482

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6519, 8-amino-7-oxononanoate biosynthesis I: PWY-6519
    • 9 reactions found over 11 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_4620&oldid=22683"