Difference between revisions of "Tiso gene 8041"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == * smiles: ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) * inchi key: ** InChIKey=MR...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14873 CPD-14873] == |
* smiles: | * smiles: | ||
− | ** C | + | ** C(=O)([O-])C1(C=C(N)C(O)=CC=1) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M |
* common name: | * common name: | ||
− | ** | + | ** 3-amino-4-hydroxybenzoate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 152.129 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 3-amino-4-hydroxybenzoic acid |
− | ** | + | ** 3,4-AHBA |
+ | ** 5-amino saliciylic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-13870]] | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54694272 54694272] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.58593.html 58593] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60005 60005] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C12115 C12115] |
− | + | {{#set: smiles=C(=O)([O-])C1(C=C(N)C(O)=CC=1)}} | |
− | {{#set: smiles=C | + | {{#set: inchi key=InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: common name=3-amino-4-hydroxybenzoate}} |
− | {{#set: common name= | + | {{#set: molecular weight=152.129 }} |
− | {{#set: molecular weight= | + | {{#set: common name=3-amino-4-hydroxybenzoic acid|3,4-AHBA|5-amino saliciylic acid}} |
− | {{#set: common name= | + | {{#set: reversible reaction associated=RXN-13870}} |
− | {{#set: | + |
Revision as of 19:13, 18 March 2018
Contents
Metabolite CPD-14873
- smiles:
- C(=O)([O-])C1(C=C(N)C(O)=CC=1)
- inchi key:
- InChIKey=MRBKRZAPGUCWOS-UHFFFAOYSA-M
- common name:
- 3-amino-4-hydroxybenzoate
- molecular weight:
- 152.129
- Synonym(s):
- 3-amino-4-hydroxybenzoic acid
- 3,4-AHBA
- 5-amino saliciylic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(C=C(N)C(O)=CC=1)" cannot be used as a page name in this wiki.