Difference between revisions of "TRANS-D2-ENOYL-COA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6660 PWY-6660] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6660 PWY-6660] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-heptyl-3,4-dihydroxyquinoline biosynthesis |
− | + | ** Pseudomonas quinolone signal biosynthesis | |
− | + | ** PQS biosynthesis | |
− | ** | + | |
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''1''' reactions found over '''9''' reactions in the full pathway |
− | == Reaction(s) | + | * [[ANTHRANSYN-RXN]] |
− | * [[ | + | ** 1 associated gene(s): |
− | == | + | *** [[Tiso_gene_11176]] |
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=AMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11849 RXN-11849] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17702 RXN-17702] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17703 RXN-17703] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17705 RXN-17705] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17707 RXN-17707] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17708 RXN-17708] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17709 RXN-17709] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis}} | |
− | + | {{#set: common name=2-heptyl-3,4-dihydroxyquinoline biosynthesis|Pseudomonas quinolone signal biosynthesis|PQS biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=9}} | |
− | {{#set: | + | {{#set: completion rate=11.0}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 18:13, 18 March 2018
Pathway PWY-6660
- taxonomic range:
- common name:
- 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis
- Synonym(s):
- 2-heptyl-3,4-dihydroxyquinoline biosynthesis
- Pseudomonas quinolone signal biosynthesis
- PQS biosynthesis
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- ANTHRANSYN-RXN
- 1 associated gene(s):
- 4 reconstruction source(s) associated: