Difference between revisions of "TRANS-D2-ENOYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-] * inchi key: ** InCh...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6660 PWY-6660] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14927 CPD-14927] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6660 PWY-6660] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M
+
 
* common name:
 
* common name:
** phytenate
+
** 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis
* molecular weight:
+
** 309.511   
+
 
* Synonym(s):
 
* Synonym(s):
** 2E-phytenate
+
** 2-heptyl-3,4-dihydroxyquinoline biosynthesis
** 2E-phytenic acid
+
** Pseudomonas quinolone signal biosynthesis
** 3,7,11,15-tetramethyl-2E-hexadecenoic acid
+
** PQS biosynthesis
** (E)-3,7,11,15-tetramethylhexadec-2-enoic acid
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-480]]
+
'''1''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[ANTHRANSYN-RXN]]
* [[RXN66-479]]
+
** 1 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_11176]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=AMINOBENZCOALIG-RXN AMINOBENZCOALIG-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11849 RXN-11849]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17702 RXN-17702]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17703 RXN-17703]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17705 RXN-17705]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17707 RXN-17707]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17708 RXN-17708]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17709 RXN-17709]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104010024
+
{{#set: taxonomic range=TAX-2}}
* PUBCHEM:
+
{{#set: common name=2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40561589 40561589]
+
{{#set: common name=2-heptyl-3,4-dihydroxyquinoline biosynthesis|Pseudomonas quinolone signal biosynthesis|PQS biosynthesis}}
* CHEMSPIDER:
+
{{#set: reaction found=1}}
** [http://www.chemspider.com/Chemical-Structure.4471755.html 4471755]
+
{{#set: total reaction=9}}
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(=O)[O-]}}
+
{{#set: completion rate=11.0}}
{{#set: inchi key=InChIKey=WDWBNNBRPVEEOD-PFXVRADUSA-M}}
+
{{#set: common name=phytenate}}
+
{{#set: molecular weight=309.511    }}
+
{{#set: common name=2E-phytenate|2E-phytenic acid|3,7,11,15-tetramethyl-2E-hexadecenoic acid|(E)-3,7,11,15-tetramethylhexadec-2-enoic acid}}
+
{{#set: consumed by=RXN66-480}}
+
{{#set: produced by=RXN66-479}}
+

Revision as of 18:13, 18 March 2018

Pathway PWY-6660

  • taxonomic range:
  • common name:
    • 2-heptyl-3-hydroxy-4(1H)-quinolone biosynthesis
  • Synonym(s):
    • 2-heptyl-3,4-dihydroxyquinoline biosynthesis
    • Pseudomonas quinolone signal biosynthesis
    • PQS biosynthesis

Reaction(s) found

1 reactions found over 9 reactions in the full pathway

Reaction(s) not found

External links