Difference between revisions of "PWY-6123"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_82 == * left end position: ** 38006 * transcription direction: ** POSITIVE * right end position: ** 41871 * centisome position: ** 80.48367...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == * smiles: ** [CH](=O)C1(=CC=C(O)C(N)=C1) * inchi key: ** InChIKey=LMGGPKY...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7367 CPD-7367] == |
| − | * | + | * smiles: |
| − | ** | + | ** [CH](=O)C1(=CC=C(O)C(N)=C1) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** 3-amino-4-hydroxybenzaldehyde |
| − | * | + | * molecular weight: |
| − | ** | + | ** 137.138 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN-13871]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11521082 11521082] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78237 78237] |
| − | {{#set: reaction associated= | + | {{#set: smiles=[CH](=O)C1(=CC=C(O)C(N)=C1)}} |
| − | + | {{#set: inchi key=InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N}} | |
| + | {{#set: common name=3-amino-4-hydroxybenzaldehyde}} | ||
| + | {{#set: molecular weight=137.138 }} | ||
| + | {{#set: reversible reaction associated=RXN-13871}} | ||
Revision as of 18:13, 18 March 2018
Contents
Metabolite CPD-7367
- smiles:
- [CH](=O)C1(=CC=C(O)C(N)=C1)
- inchi key:
- InChIKey=LMGGPKYAWHDOLR-UHFFFAOYSA-N
- common name:
- 3-amino-4-hydroxybenzaldehyde
- molecular weight:
- 137.138
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C1(=CC=C(O)C(N)=C1)" cannot be used as a page name in this wiki.
