Difference between revisions of "Tiso gene 8689"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6702 CPD-6702] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])(=O)[O-])C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Gene == Gene Tiso_gene_3691 == * left end position: ** 7038 * transcription direction: ** NEGATIVE * right end position: ** 10040 * centisome position: ** 43.5546...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_3691 == |
− | * | + | * left end position: |
− | ** | + | ** 7038 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 10040 |
− | * | + | * centisome position: |
− | ** | + | ** 43.554676 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[FUMHYDR-RXN]] |
− | + | ** in-silico_annotation | |
− | == | + | ***ec-number |
+ | ** experimental_annotation | ||
+ | ***ec-number | ||
+ | ** [[pantograph]]-[[esiliculosus]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-561]] | ||
+ | * [[PWY-5913]] | ||
+ | * [[P42-PWY]] | ||
+ | * [[PWY-7384]] | ||
+ | * [[PWY-5392]] | ||
+ | * [[P23-PWY]] | ||
+ | * [[P105-PWY]] | ||
+ | * [[PWY-6969]] | ||
+ | * [[PWY-6728]] | ||
+ | * [[REDCITCYC]] | ||
+ | * [[PWY-7254]] | ||
+ | * [[P108-PWY]] | ||
+ | * [[PWY-5690]] | ||
+ | * [[PWY66-398]] | ||
+ | * [[TCA]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=7038}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=10040}} | |
− | + | {{#set: centisome position=43.554676 }} | |
− | {{#set: | + | {{#set: reaction associated=FUMHYDR-RXN}} |
− | {{#set: | + | {{#set: pathway associated=FERMENTATION-PWY|PWY-561|PWY-5913|P42-PWY|PWY-7384|PWY-5392|P23-PWY|P105-PWY|PWY-6969|PWY-6728|REDCITCYC|PWY-7254|P108-PWY|PWY-5690|PWY66-398|TCA}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Revision as of 19:14, 18 March 2018
Gene Tiso_gene_3691
- left end position:
- 7038
- transcription direction:
- NEGATIVE
- right end position:
- 10040
- centisome position:
- 43.554676
- Synonym(s):
Reactions associated
- FUMHYDR-RXN
- in-silico_annotation
- ec-number
- experimental_annotation
- ec-number
- pantograph-esiliculosus
- pantograph-creinhardtii
- in-silico_annotation
Pathways associated
- FERMENTATION-PWY
- PWY-561
- PWY-5913
- P42-PWY
- PWY-7384
- PWY-5392
- P23-PWY
- P105-PWY
- PWY-6969
- PWY-6728
- REDCITCYC
- PWY-7254
- P108-PWY
- PWY-5690
- PWY66-398
- TCA