Difference between revisions of "GLYCERONE-KINASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiols Thiols] == * common name: ** a thiol * Synonym(s): ** a mercaptan == Reaction(s) known...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == |
+ | * smiles: | ||
+ | ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9)))) | ||
* common name: | * common name: | ||
− | ** a | + | ** chlorophyllide a |
+ | * molecular weight: | ||
+ | ** 612.967 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** chlorophyllide |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7663]] |
+ | * [[RXN-7676]] | ||
+ | * [[RXN-13398]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-5286]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN1F-10]] | ||
+ | * [[RXN1F-66]] | ||
== External links == | == External links == | ||
− | {{#set: common name=a | + | * CAS : 14897-06-4 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by=RXN- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368] |
− | {{#set: produced by= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139] | ||
+ | {{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}} | ||
+ | {{#set: common name=chlorophyllide a}} | ||
+ | {{#set: molecular weight=612.967 }} | ||
+ | {{#set: common name=chlorophyllide}} | ||
+ | {{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}} | ||
+ | {{#set: produced by=RXN-5286}} | ||
+ | {{#set: reversible reaction associated=RXN1F-10|RXN1F-66}} |
Revision as of 18:14, 18 March 2018
Contents
Metabolite CHLOROPHYLLIDE-A
- smiles:
- C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
- common name:
- chlorophyllide a
- molecular weight:
- 612.967
- Synonym(s):
- chlorophyllide
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))" cannot be used as a page name in this wiki.