Difference between revisions of "Tiso gene 805"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * smiles: ** C(C1(C=CC(=CC=1)O))(=O)[O-] * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHITIN CHITIN] == * common name: ** chitin * Synonym(s): ** [GlcNAc]n ** beta-1,4-Poly-N-acetyl...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHITIN CHITIN] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** chitin |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** [GlcNAc]n |
| + | ** beta-1,4-Poly-N-acetyl-D-glucosamine | ||
| + | ** (1→4)-2-acetamido-2-deoxy-β-D-glucan | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-18082]] | |
| − | * [[RXN- | + | * [[3.2.1.14-RXN]] |
| − | * [[2 | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18082]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=chitin}} | |
| − | + | {{#set: common name=[GlcNAc]n|beta-1,4-Poly-N-acetyl-D-glucosamine|(1→4)-2-acetamido-2-deoxy-β-D-glucan}} | |
| − | + | {{#set: consumed by=RXN-18082|3.2.1.14-RXN}} | |
| − | + | {{#set: produced by=RXN-18082}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name=4- | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
Revision as of 18:14, 18 March 2018
Contents
Metabolite CHITIN
- common name:
- chitin
- Synonym(s):
- [GlcNAc]n
- beta-1,4-Poly-N-acetyl-D-glucosamine
- (1→4)-2-acetamido-2-deoxy-β-D-glucan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"GlcNAc]n" cannot be used as a page name in this wiki.
