Difference between revisions of "Tiso gene 10055"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ORNITHINE L-ORNITHINE] == * smiles: ** C(C[N+])CC([N+])C([O-])=O * inchi key: ** InChIKey=AHL...") |
(Created page with "Category:Gene == Gene Tiso_gene_1360 == * left end position: ** 19653 * transcription direction: ** NEGATIVE * right end position: ** 20580 * centisome position: ** 81.070...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_1360 == |
− | * | + | * left end position: |
− | ** | + | ** 19653 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 20580 |
− | * | + | * centisome position: |
− | ** | + | ** 81.07004 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ATPASE-RXN]] |
− | * | + | ** in-silico_annotation |
− | * | + | ***ec-number |
− | + | == Pathways associated == | |
− | + | ||
− | * | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=19653}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=20580}} | |
− | + | {{#set: centisome position=81.07004 }} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:15, 18 March 2018
Gene Tiso_gene_1360
- left end position:
- 19653
- transcription direction:
- NEGATIVE
- right end position:
- 20580
- centisome position:
- 81.07004
- Synonym(s):
Reactions associated
- ATPASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation