Difference between revisions of "ADCLY-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] == * direction: ** REVERSIBLE * common name: ** S-Adenosyl-L-methionine reversible...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2m AMETt2m] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-706 CPD-706] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
 
* common name:
 
* common name:
−
** S-Adenosyl-L-methionine reversible transport, mitochondrial
+
** 24-methylenecholesterol
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[S-ADENOSYLMETHIONINE]][m] '''+''' 1.0 [[ADENOSYL-HOMO-CYS]][c] '''<=>''' 1.0 [[ADENOSYL-HOMO-CYS]][m] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][c]
+
* [[RXN-707]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 S-adenosyl-L-methionine[m] '''+''' 1.0 S-adenosyl-L-homocysteine[c] '''<=>''' 1.0 S-adenosyl-L-homocysteine[m] '''+''' 1.0 S-adenosyl-L-methionine[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3756]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_8828]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=S-Adenosyl-L-methionine reversible transport, mitochondrial}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92113 92113]
−
{{#set: gene associated=Tiso_gene_3756|Tiso_gene_8828}}
+
* LIGAND-CPD:
−
{{#set: in pathway=}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15781 C15781]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB06849
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: inchi key=InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N}}
 +
{{#set: common name=24-methylenecholesterol}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: produced by=RXN-707}}

Revision as of 18:16, 18 March 2018

Metabolite CPD-706

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=INDVLXYUCBVVKW-PXBBAZSNSA-N
  • common name:
    • 24-methylenecholesterol
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ADCLY-RXN&oldid=23063"