Difference between revisions of "Tiso gene 1006"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4463 == * left end position: ** 3027 * transcription direction: ** NEGATIVE * right end position: ** 5657 * centisome position: ** 20.43613...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * inchi key: *...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4463 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] ==
−
* left end position:
+
* smiles:
−
** 3027
+
** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
−
* right end position:
+
* common name:
−
** 5657
+
** γ-L-glutamyl-glycylglycine
−
* centisome position:
+
* molecular weight:
−
** 20.436134    
+
** 260.226    
 
* Synonym(s):
 
* Synonym(s):
 +
** γ-L-Glu-Gly-Gly
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[MALONYL-COA-DECARBOXYLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN-18092]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[RXN-1321]]
+
−
** in-silico_annotation
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-5410]]
+
−
* [[PWY-735]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3027}}
+
{{#set: smiles=C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O}}
−
{{#set: transcription direction=NEGATIVE}}
+
{{#set: inchi key=InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M}}
−
{{#set: right end position=5657}}
+
{{#set: common name=γ-L-glutamyl-glycylglycine}}
−
{{#set: centisome position=20.436134   }}
+
{{#set: molecular weight=260.226   }}
−
{{#set: reaction associated=MALONYL-COA-DECARBOXYLASE-RXN|RXN-1321}}
+
{{#set: common name=γ-L-Glu-Gly-Gly}}
−
{{#set: pathway associated=PWY-5410|PWY-735}}
+
{{#set: produced by=RXN-18092}}

Revision as of 18:16, 18 March 2018

Metabolite CPD-19395

  • smiles:
    • C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O
  • inchi key:
    • InChIKey=RWAZIEYJAWTKLB-YFKPBYRVSA-M
  • common name:
    • γ-L-glutamyl-glycylglycine
  • molecular weight:
    • 260.226
  • Synonym(s):
    • γ-L-Glu-Gly-Gly

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1006&oldid=23072"