Difference between revisions of "Tiso gene 13686"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * smiles: ** C(NC(CCC(C(=O)[O-])[N+])=O)C(NCC(=O)[O-])=O * inchi key: *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLITOL XYLITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * inchi key: ** InChIKey=HEBKCHPVOIAQTA-SCD...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XYLITOL XYLITOL] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(O)C(O)C(O)C(O)CO |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=HEBKCHPVOIAQTA-SCDXWVJYSA-N |
* common name: | * common name: | ||
| − | ** | + | ** xylitol |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 152.147 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (2R,3R,4S)-pentane-1,2,3,4,5-pentaol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.1.3.41-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-8773]] | ||
== External links == | == External links == | ||
| − | {{#set: smiles=C( | + | * CAS : 87-99-0 |
| − | {{#set: inchi key=InChIKey= | + | * Wikipedia : Xylitol |
| − | {{#set: common name= | + | * DRUGBANK : DB01904 |
| − | {{#set: molecular weight= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6912 6912] |
| − | {{#set: | + | * HMDB : HMDB02917 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00379 C00379] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.6646.html 6646] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17151 17151] | ||
| + | * METABOLIGHTS : MTBLC17151 | ||
| + | {{#set: smiles=C(O)C(O)C(O)C(O)CO}} | ||
| + | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-SCDXWVJYSA-N}} | ||
| + | {{#set: common name=xylitol}} | ||
| + | {{#set: molecular weight=152.147 }} | ||
| + | {{#set: common name=(2R,3R,4S)-pentane-1,2,3,4,5-pentaol}} | ||
| + | {{#set: consumed by=1.1.3.41-RXN}} | ||
| + | {{#set: reversible reaction associated=RXN-8773}} | ||
Revision as of 18:16, 18 March 2018
Contents
Metabolite XYLITOL
- smiles:
- C(O)C(O)C(O)C(O)CO
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-SCDXWVJYSA-N
- common name:
- xylitol
- molecular weight:
- 152.147
- Synonym(s):
- (2R,3R,4S)-pentane-1,2,3,4,5-pentaol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 87-99-0
- Wikipedia : Xylitol
- DRUGBANK : DB01904
- PUBCHEM:
- HMDB : HMDB02917
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17151
